C31H26BrCl2N3O2S — CID 137044284
(5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137044284) has the molecular formula C31H26BrCl2N3O2S and a molecular weight of 655.45 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044284 |
| Molecular Formula | C31H26BrCl2N3O2S |
| Molecular Weight | 655.45 g/mol |
| Exact Mass | 653.03 |
| IUPAC Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/N=C2/NC(=O)/C(=C/c3cc(C)n(-c4ccc(OCc5ccc(Cl)cc5Cl)cc4)c3C)S2)cc(C)c1Br |
| InChI | InChI=1S/C31H26BrCl2N3O2S/c1-17-11-24(12-18(2)29(17)32)35-31-36-30(38)28(40-31)14-22-13-19(3)37(20(22)4)25-7-9-26(10-8-25)39-16-21-5-6-23(33)15-27(21)34/h5-15H,16H2,1-4H3,(H,35,36,38)/b28-14- |
| InChIKey | VWSQRARARWUOGE-MUXKCCDJSA-N |
| XLogP | 9.25 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.45 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|