C29H22BrCl2N3O2S — CID 137107706
(5Z)-5-[[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137107706) has the molecular formula C29H22BrCl2N3O2S and a molecular weight of 627.39 g/mol. Its IUPAC name is (5Z)-5-[[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137107706 |
| Molecular Formula | C29H22BrCl2N3O2S |
| Molecular Weight | 627.39 g/mol |
| Exact Mass | 625.00 |
| IUPAC Name | (5Z)-5-[[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N/c3ccc(Cl)c(Cl)c3)NC2=O)c(C)n1-c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C29H22BrCl2N3O2S/c1-17-13-20(14-27-28(36)34-29(38-27)33-22-7-12-25(31)26(32)15-22)18(2)35(17)23-8-10-24(11-9-23)37-16-19-3-5-21(30)6-4-19/h3-15H,16H2,1-2H3,(H,33,34,36)/b27-14- |
| InChIKey | VZPCABGDROVQQT-VYYCAZPPSA-N |
| XLogP | 8.63 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.39 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|