C26H25BrClN3OS — CID 137107566
(5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137107566) has the molecular formula C26H25BrClN3OS and a molecular weight of 542.93 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137107566 |
| Molecular Formula | C26H25BrClN3OS |
| Molecular Weight | 542.93 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | (5Z)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N/c3ccc(Br)c(Cl)c3)NC2=O)c(C)n1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H25BrClN3OS/c1-15-12-17(16(2)31(15)20-9-6-18(7-10-20)26(3,4)5)13-23-24(32)30-25(33-23)29-19-8-11-21(27)22(28)14-19/h6-14H,1-5H3,(H,29,30,32)/b23-13- |
| InChIKey | JXLWAMYJLGYGCX-QRVIBDJDSA-N |
| XLogP | 7.70 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.93 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|