C30H26ClN3O2S — CID 137136517
(5E)-2-(3-chloro-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137136517) has the molecular formula C30H26ClN3O2S and a molecular weight of 528.08 g/mol. Its IUPAC name is (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136517 |
| Molecular Formula | C30H26ClN3O2S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1c(Cl)cccc1/N=C1/NC(=O)/C(=C\c2cc(C)n(-c3ccc(OCc4ccccc4)cc3)c2C)S1 |
| InChI | InChI=1S/C30H26ClN3O2S/c1-19-16-23(17-28-29(35)33-30(37-28)32-27-11-7-10-26(31)20(27)2)21(3)34(19)24-12-14-25(15-13-24)36-18-22-8-5-4-6-9-22/h4-17H,18H2,1-3H3,(H,32,33,35)/b28-17+ |
| InChIKey | HLTROFSMAIDEPS-OGLMXYFKSA-N |
| XLogP | 7.53 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|