C25H22ClN3O3S — CID 137138886
2-chloro-5-[3-[(Z)-[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid (PubChem CID 137138886) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-chloro-5-[3-[(Z)-[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[(Z)-[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 137138886 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-chloro-5-[3-[(Z)-[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1cccc(/N=C2\NC(=O)/C(=C/c3cc(C)n(-c4ccc(Cl)c(C(=O)O)c4)c3C)S2)c1C |
| InChI | InChI=1S/C25H22ClN3O3S/c1-13-6-5-7-21(15(13)3)27-25-28-23(30)22(33-25)11-17-10-14(2)29(16(17)4)18-8-9-20(26)19(12-18)24(31)32/h5-12H,1-4H3,(H,31,32)(H,27,28,30)/b22-11- |
| InChIKey | NJJKGFSUDZMEPH-JJFYIABZSA-N |
| XLogP | 5.95 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|