C25H20ClN3O5S — CID 137118342
5-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 137118342) has the molecular formula C25H20ClN3O5S and a molecular weight of 509.97 g/mol. Its IUPAC name is 5-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 137118342 |
| Molecular Formula | C25H20ClN3O5S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 5-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(Cl)cccc1/N=C1\NC(=O)/C(=C/c2cc(C)n(-c3cc(C(=O)O)cc(C(=O)O)c3)c2C)S1 |
| InChI | InChI=1S/C25H20ClN3O5S/c1-12-7-15(14(3)29(12)18-9-16(23(31)32)8-17(10-18)24(33)34)11-21-22(30)28-25(35-21)27-20-6-4-5-19(26)13(20)2/h4-11H,1-3H3,(H,31,32)(H,33,34)(H,27,28,30)/b21-11- |
| InChIKey | CLEJYIGJNYPKBQ-NHDPSOOVSA-N |
| XLogP | 5.34 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|