C28H28ClN3O3S — CID 137064862
butyl 4-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 137064862) has the molecular formula C28H28ClN3O3S and a molecular weight of 522.07 g/mol. Its IUPAC name is butyl 4-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 137064862 |
| Molecular Formula | C28H28ClN3O3S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | butyl 4-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2c(C)cc(/C=C3\S/C(=N/c4cccc(Cl)c4C)NC3=O)c2C)cc1 |
| InChI | InChI=1S/C28H28ClN3O3S/c1-5-6-14-35-27(34)20-10-12-22(13-11-20)32-17(2)15-21(19(32)4)16-25-26(33)31-28(36-25)30-24-9-7-8-23(29)18(24)3/h7-13,15-16H,5-6,14H2,1-4H3,(H,30,31,33)/b25-16- |
| InChIKey | YJBXGEKBVWGKAT-XYGWBWBKSA-N |
| XLogP | 6.90 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|