C26H25Cl2N3OS — CID 137080885
(5E)-5-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137080885) has the molecular formula C26H25Cl2N3OS and a molecular weight of 498.48 g/mol. Its IUPAC name is (5E)-5-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137080885 |
| Molecular Formula | C26H25Cl2N3OS |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (5E)-5-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCCc1ccc(-n2c(C)cc(/C=C3/S/C(=N\c4cccc(Cl)c4Cl)NC3=O)c2C)cc1 |
| InChI | InChI=1S/C26H25Cl2N3OS/c1-4-5-7-18-10-12-20(13-11-18)31-16(2)14-19(17(31)3)15-23-25(32)30-26(33-23)29-22-9-6-8-21(27)24(22)28/h6,8-15H,4-5,7H2,1-3H3,(H,29,30,32)/b23-15+ |
| InChIKey | YZMDUOUDGIDYIV-HZHRSRAPSA-N |
| XLogP | 7.64 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|