C24H21ClFN3OS — CID 135592677
(5E)-5-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135592677) has the molecular formula C24H21ClFN3OS and a molecular weight of 453.97 g/mol. Its IUPAC name is (5E)-5-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135592677 |
| Molecular Formula | C24H21ClFN3OS |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (5E)-5-[[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2/NC(=O)/C(=C\c3cc(C)n(-c4ccc(F)c(Cl)c4)c3C)S2)c1C |
| InChI | InChI=1S/C24H21ClFN3OS/c1-13-6-5-7-21(15(13)3)27-24-28-23(30)22(31-24)11-17-10-14(2)29(16(17)4)18-8-9-20(26)19(25)12-18/h5-12H,1-4H3,(H,27,28,30)/b22-11+ |
| InChIKey | YCXILSTXNGGRDN-SSDVNMTOSA-N |
| XLogP | 6.40 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|