C17H13ClN2O3S2 — CID 126005631
2-chloro-5-[2,5-dimethyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid (PubChem CID 126005631) has the molecular formula C17H13ClN2O3S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-chloro-5-[2,5-dimethyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[2,5-dimethyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126005631 |
| Molecular Formula | C17H13ClN2O3S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-chloro-5-[2,5-dimethyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
| SMILES | Cc1cc(/C=C2\SC(=S)NC2=O)c(C)n1-c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H13ClN2O3S2/c1-8-5-10(6-14-15(21)19-17(24)25-14)9(2)20(8)11-3-4-13(18)12(7-11)16(22)23/h3-7H,1-2H3,(H,22,23)(H,19,21,24)/b14-6- |
| InChIKey | RDMZVXWCBZFDAT-NSIKDUERSA-N |
| XLogP | 3.93 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|