C20H19BrN2O3S — CID 137020296
(5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137020296) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020296 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,5-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(OC)c(/C=C2\S/C(=N/c3cc(C)c(Br)c(C)c3)NC2=O)c1 |
| InChI | InChI=1S/C20H19BrN2O3S/c1-11-7-14(8-12(2)18(11)21)22-20-23-19(24)17(27-20)10-13-9-15(25-3)5-6-16(13)26-4/h5-10H,1-4H3,(H,22,23,24)/b17-10- |
| InChIKey | QTBYZWMYZOZDOZ-YVLHZVERSA-N |
| XLogP | 4.97 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|