C16H8ClF4NO — CID 955225
(3E)-3-[(2-chloro-6-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 955225) has the molecular formula C16H8ClF4NO and a molecular weight of 341.69 g/mol. Its IUPAC name is (3E)-3-[(2-chloro-6-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(2-chloro-6-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 955225 |
| Molecular Formula | C16H8ClF4NO |
| Molecular Weight | 341.69 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (3E)-3-[(2-chloro-6-fluorophenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2/C1=C\c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H8ClF4NO/c17-12-2-1-3-13(18)11(12)7-10-9-5-4-8(16(19,20)21)6-14(9)22-15(10)23/h1-7H,(H,22,23)/b10-7+ |
| InChIKey | VVPDSDFRHBVYJH-JXMROGBWSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|