C26H27N3O2 — CID 3419928
3-[[1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 3419928) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[[1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 3419928 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[[1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | CC1CCCC(C)N1C(=O)Cn1cc(C=C2C(=O)Nc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O2/c1-17-8-7-9-18(2)29(17)25(30)16-28-15-19(20-10-4-6-13-24(20)28)14-22-21-11-3-5-12-23(21)27-26(22)31/h3-6,10-15,17-18H,7-9,16H2,1-2H3,(H,27,31) |
| InChIKey | YVQULGCTJAIVKM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|