C28H25N3O2 — CID 11977997
2-[3-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 11977997) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[3-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[3-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 11977997 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[3-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2/C(=O)Nc3ccccc32)c2ccccc21)NCCCc1ccccc1 |
| InChI | InChI=1S/C28H25N3O2/c32-27(29-16-8-11-20-9-2-1-3-10-20)19-31-18-21(22-12-5-7-15-26(22)31)17-24-23-13-4-6-14-25(23)30-28(24)33/h1-7,9-10,12-15,17-18H,8,11,16,19H2,(H,29,32)(H,30,33)/b24-17+ |
| InChIKey | SLQDOBPZNFXDRZ-JJIBRWJFSA-N |
| XLogP | 4.88 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|