C28H30N4O3 — CID 73159722
N-[3-(1-formylpiperidin-4-yl)propyl]-2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 73159722) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[3-(1-formylpiperidin-4-yl)propyl]-2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N-[3-(1-formylpiperidin-4-yl)propyl]-2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 73159722 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[3-(1-formylpiperidin-4-yl)propyl]-2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | O=CN1CCC(CCCNC(=O)Cn2cc(C=C3C(=O)Nc4ccccc43)c3ccccc32)CC1 |
| InChI | InChI=1S/C28H30N4O3/c33-19-31-14-11-20(12-15-31)6-5-13-29-27(34)18-32-17-21(22-7-2-4-10-26(22)32)16-24-23-8-1-3-9-25(23)30-28(24)35/h1-4,7-10,16-17,19-20H,5-6,11-15,18H2,(H,29,34)(H,30,35) |
| InChIKey | UVSZMKBCQHELEI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|