C19H17N3O3S — CID 67114937
3-[(1-ethylindol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 67114937) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-[(1-ethylindol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[(1-ethylindol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 67114937 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[(1-ethylindol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CCn1cc(C=C2C(=O)Nc3ccc(S(N)(=O)=O)cc32)c2ccccc21 |
| InChI | InChI=1S/C19H17N3O3S/c1-2-22-11-12(14-5-3-4-6-18(14)22)9-16-15-10-13(26(20,24)25)7-8-17(15)21-19(16)23/h3-11H,2H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | QUFKPPULNDYOPK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|