C13H12N4O3S — CID 94468993
(3E)-3-[(1-methylpyrazol-4-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 94468993) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is (3E)-3-[(1-methylpyrazol-4-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3E)-3-[(1-methylpyrazol-4-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 94468993 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (3E)-3-[(1-methylpyrazol-4-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | Cn1cc(/C=C2/C(=O)Nc3ccc(S(N)(=O)=O)cc32)cn1 |
| InChI | InChI=1S/C13H12N4O3S/c1-17-7-8(6-15-17)4-11-10-5-9(21(14,19)20)2-3-12(10)16-13(11)18/h2-7H,1H3,(H,16,18)(H2,14,19,20)/b11-4+ |
| InChIKey | QEKJWOKGCNMZQP-NYYWCZLTSA-N |
| XLogP | 0.56 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|