C19H18N2O6S — CID 166217975
methyl 2-[4-[(E)-(2-oxo-5-sulfamoyl-1H-indol-3-ylidene)methyl]phenoxy]propanoate (PubChem CID 166217975) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(2-oxo-5-sulfamoyl-1H-indol-3-ylidene)methyl]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[(E)-(2-oxo-5-sulfamoyl-1H-indol-3-ylidene)methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 166217975 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | methyl 2-[4-[(E)-(2-oxo-5-sulfamoyl-1H-indol-3-ylidene)methyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(/C=C2/C(=O)Nc3ccc(S(N)(=O)=O)cc32)cc1 |
| InChI | InChI=1S/C19H18N2O6S/c1-11(19(23)26-2)27-13-5-3-12(4-6-13)9-16-15-10-14(28(20,24)25)7-8-17(15)21-18(16)22/h3-11H,1-2H3,(H,21,22)(H2,20,24,25)/b16-9+ |
| InChIKey | MPHOYVBEUMALQJ-CXUHLZMHSA-N |
| XLogP | 1.77 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|