C18H17N3O5S — CID 60512255
(3E)-3-[(3-nitro-4-propan-2-ylphenyl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 60512255) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is (3E)-3-[(3-nitro-4-propan-2-ylphenyl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3E)-3-[(3-nitro-4-propan-2-ylphenyl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 60512255 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (3E)-3-[(3-nitro-4-propan-2-ylphenyl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CC(C)c1ccc(/C=C2/C(=O)Nc3ccc(S(N)(=O)=O)cc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N3O5S/c1-10(2)13-5-3-11(8-17(13)21(23)24)7-15-14-9-12(27(19,25)26)4-6-16(14)20-18(15)22/h3-10H,1-2H3,(H,20,22)(H2,19,25,26)/b15-7+ |
| InChIKey | GEXIFAXAGXBNAM-VIZOYTHASA-N |
| XLogP | 2.86 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|