C18H13N5O3S — CID 3886738
3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1H-indol-2-one (PubChem CID 3886738) has the molecular formula C18H13N5O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 3886738 |
| Molecular Formula | C18H13N5O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1H-indol-2-one |
| SMILES | Cn1cnnc1Sc1ccc(C=C2C(=O)Nc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13N5O3S/c1-22-10-19-21-18(22)27-16-7-6-11(9-15(16)23(25)26)8-13-12-4-2-3-5-14(12)20-17(13)24/h2-10H,1H3,(H,20,24) |
| InChIKey | RVVNSHOGRUPOBG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|