C15H18N6O4S — CID 6904997
tert-butyl N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]carbamate (PubChem CID 6904997) has the molecular formula C15H18N6O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is tert-butyl N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6904997 |
| Molecular Formula | C15H18N6O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | tert-butyl N-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]carbamate |
| SMILES | Cn1cnnc1Sc1ccc(/C=N/NC(=O)OC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N6O4S/c1-15(2,3)25-14(22)19-16-8-10-5-6-12(11(7-10)21(23)24)26-13-18-17-9-20(13)4/h5-9H,1-4H3,(H,19,22)/b16-8+ |
| InChIKey | ILKMVNMBGCMORZ-LZYBPNLTSA-N |
| XLogP | 2.73 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|