C18H16ClN7O2S2 — CID 6904911
1-(3-chloro-2-methylphenyl)-3-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]thiourea (PubChem CID 6904911) has the molecular formula C18H16ClN7O2S2 and a molecular weight of 461.96 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6904911 |
| Molecular Formula | C18H16ClN7O2S2 |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(E)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N/N=C/c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClN7O2S2/c1-11-13(19)4-3-5-14(11)22-17(29)23-20-9-12-6-7-16(15(8-12)26(27)28)30-18-24-21-10-25(18)2/h3-10H,1-2H3,(H2,22,23,29)/b20-9+ |
| InChIKey | WGOVSTMGIULMTN-AWQFTUOYSA-N |
| XLogP | 4.16 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|