C19H11Cl2N5O4S — CID 2441824
(4E)-2-(2,4-dichlorophenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2441824) has the molecular formula C19H11Cl2N5O4S and a molecular weight of 476.30 g/mol. Its IUPAC name is (4E)-2-(2,4-dichlorophenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2,4-dichlorophenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2441824 |
| Molecular Formula | C19H11Cl2N5O4S |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | (4E)-2-(2,4-dichlorophenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | Cn1cnnc1Sc1ccc(/C=C2/N=C(c3ccc(Cl)cc3Cl)OC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H11Cl2N5O4S/c1-25-9-22-24-19(25)31-16-5-2-10(7-15(16)26(28)29)6-14-18(27)30-17(23-14)12-4-3-11(20)8-13(12)21/h2-9H,1H3/b14-6+ |
| InChIKey | WBCHMGBJKVBMAC-MKMNVTDBSA-N |
| XLogP | 4.53 |
| TPSA | 112.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|