C22H11Cl2N3O7 — CID 19670005
(4Z)-2-(2,4-dichlorophenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19670005) has the molecular formula C22H11Cl2N3O7 and a molecular weight of 500.25 g/mol. Its IUPAC name is (4Z)-2-(2,4-dichlorophenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2,4-dichlorophenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670005 |
| Molecular Formula | C22H11Cl2N3O7 |
| Molecular Weight | 500.25 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | (4Z)-2-(2,4-dichlorophenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H11Cl2N3O7/c23-13-4-6-16(17(24)10-13)21-25-18(22(28)34-21)9-12-2-1-3-15(8-12)33-20-7-5-14(26(29)30)11-19(20)27(31)32/h1-11H/b18-9- |
| InChIKey | NQHYNUXHPFIMFW-NVMNQCDNSA-N |
| XLogP | 5.95 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.25 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|