C26H21N3O7 — CID 6051657
(4Z)-2-(4-tert-butylphenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6051657) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is (4Z)-2-(4-tert-butylphenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6051657 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1ccc(C2=N/C(=C\c3cccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H21N3O7/c1-26(2,3)18-9-7-17(8-10-18)24-27-21(25(30)36-24)14-16-5-4-6-20(13-16)35-23-12-11-19(28(31)32)15-22(23)29(33)34/h4-15H,1-3H3/b21-14- |
| InChIKey | RHXWIDKXJMPHJW-STZFKDTASA-N |
| XLogP | 5.94 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|