C23H21N5O6S — CID 2437094
(4E)-2-(3,4-diethoxyphenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2437094) has the molecular formula C23H21N5O6S and a molecular weight of 495.52 g/mol. Its IUPAC name is (4E)-2-(3,4-diethoxyphenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3,4-diethoxyphenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2437094 |
| Molecular Formula | C23H21N5O6S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (4E)-2-(3,4-diethoxyphenyl)-4-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C/c3ccc(Sc4nncn4C)c([N+](=O)[O-])c3)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C23H21N5O6S/c1-4-32-18-8-7-15(12-19(18)33-5-2)21-25-16(22(29)34-21)10-14-6-9-20(17(11-14)28(30)31)35-23-26-24-13-27(23)3/h6-13H,4-5H2,1-3H3/b16-10+ |
| InChIKey | JZOQNZWVYHTRCM-MHWRWJLKSA-N |
| XLogP | 4.02 |
| TPSA | 130.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|