C16H7BrCl2N2O4 — CID 4126227
4-[(4-bromo-3-nitrophenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 4126227) has the molecular formula C16H7BrCl2N2O4 and a molecular weight of 442.05 g/mol. Its IUPAC name is 4-[(4-bromo-3-nitrophenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(4-bromo-3-nitrophenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4126227 |
| Molecular Formula | C16H7BrCl2N2O4 |
| Molecular Weight | 442.05 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | 4-[(4-bromo-3-nitrophenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(Cl)ccc2Cl)=NC1=Cc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H7BrCl2N2O4/c17-11-3-1-8(6-14(11)21(23)24)5-13-16(22)25-15(20-13)10-7-9(18)2-4-12(10)19/h1-7H |
| InChIKey | HUEFXWMQGHIIDO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.05 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|