C18H12BrCl2NO4 — CID 2875503
4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 2875503) has the molecular formula C18H12BrCl2NO4 and a molecular weight of 457.11 g/mol. Its IUPAC name is 4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2875503 |
| Molecular Formula | C18H12BrCl2NO4 |
| Molecular Weight | 457.11 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | 4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(C=C2N=C(c3cc(Cl)ccc3Cl)OC2=O)cc(Br)c1OC |
| InChI | InChI=1S/C18H12BrCl2NO4/c1-24-15-7-9(5-12(19)16(15)25-2)6-14-18(23)26-17(22-14)11-8-10(20)3-4-13(11)21/h3-8H,1-2H3 |
| InChIKey | SFNQDLVXBCHMQT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.11 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|