C19H16ClNO5 — CID 6529771
(4E)-2-(5-chloro-2-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6529771) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is (4E)-2-(5-chloro-2-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(5-chloro-2-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6529771 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (4E)-2-(5-chloro-2-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(/C=C2/N=C(c3cc(Cl)ccc3OC)OC2=O)cc1OC |
| InChI | InChI=1S/C19H16ClNO5/c1-23-15-7-5-12(20)10-13(15)18-21-14(19(22)26-18)8-11-4-6-16(24-2)17(9-11)25-3/h4-10H,1-3H3/b14-8+ |
| InChIKey | DZWZCNSJEJKBIQ-RIYZIHGNSA-N |
| XLogP | 3.71 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|