C23H16ClNO7 — CID 126064308
[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 126064308) has the molecular formula C23H16ClNO7 and a molecular weight of 453.83 g/mol. Its IUPAC name is [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126064308 |
| Molecular Formula | C23H16ClNO7 |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=C2\N=C(c3cc(Cl)ccc3OC)OC2=O)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C23H16ClNO7/c1-28-17-8-6-14(24)12-15(17)21-25-16(22(26)32-21)10-13-5-7-18(20(11-13)29-2)31-23(27)19-4-3-9-30-19/h3-12H,1-2H3/b16-10- |
| InChIKey | LTWPMZKKDYVERK-YBEGLDIGSA-N |
| XLogP | 4.51 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|