C23H17NO7 — CID 26475098
[2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 26475098) has the molecular formula C23H17NO7 and a molecular weight of 419.39 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 26475098 |
| Molecular Formula | C23H17NO7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccco4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H17NO7/c1-27-16-8-6-15(7-9-16)21-24-17(22(25)31-21)12-14-5-10-18(20(13-14)28-2)30-23(26)19-4-3-11-29-19/h3-13H,1-2H3/b17-12- |
| InChIKey | ADEHKUOPKSLJRA-ATVHPVEESA-N |
| XLogP | 3.86 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|