C22H14ClNO6 — CID 2934332
[2-chloro-6-methoxy-4-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 2934332) has the molecular formula C22H14ClNO6 and a molecular weight of 423.81 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-chloro-6-methoxy-4-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2934332 |
| Molecular Formula | C22H14ClNO6 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [2-chloro-6-methoxy-4-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=C2N=C(c3ccccc3)OC2=O)cc(Cl)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H14ClNO6/c1-27-18-12-13(10-15(23)19(18)29-22(26)17-8-5-9-28-17)11-16-21(25)30-20(24-16)14-6-3-2-4-7-14/h2-12H,1H3 |
| InChIKey | OLBBJXPRIKWGNH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|