C25H17ClFNO5 — CID 19669947
[2-chloro-4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzoate (PubChem CID 19669947) has the molecular formula C25H17ClFNO5 and a molecular weight of 465.86 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [2-chloro-4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19669947 |
| Molecular Formula | C25H17ClFNO5 |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [2-chloro-4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(F)cc3)OC2=O)cc(Cl)c1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H17ClFNO5/c1-14-3-5-17(6-4-14)24(29)32-22-19(26)11-15(13-21(22)31-2)12-20-25(30)33-23(28-20)16-7-9-18(27)10-8-16/h3-13H,1-2H3/b20-12- |
| InChIKey | RFVQFPFIVALZCG-NDENLUEZSA-N |
| XLogP | 5.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|