C22H20ClNO6 — CID 78414618
[2-chloro-6-methoxy-4-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate (PubChem CID 78414618) has the molecular formula C22H20ClNO6 and a molecular weight of 429.86 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate.
| Compound Name | [2-chloro-6-methoxy-4-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 78414618 |
| Molecular Formula | C22H20ClNO6 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [2-chloro-6-methoxy-4-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(Cl)cc(C=C2N=C(c3ccc(OC)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C22H20ClNO6/c1-4-5-19(25)29-20-16(23)10-13(12-18(20)28-3)11-17-22(26)30-21(24-17)14-6-8-15(27-2)9-7-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | KDVKIFGUOVOYDM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|