C25H20ClNO5 — CID 19674602
[2-chloro-6-methoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] butanoate (PubChem CID 19674602) has the molecular formula C25H20ClNO5 and a molecular weight of 449.89 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] butanoate.
| Compound Name | [2-chloro-6-methoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 19674602 |
| Molecular Formula | C25H20ClNO5 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [2-chloro-6-methoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(Cl)cc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)cc1OC |
| InChI | InChI=1S/C25H20ClNO5/c1-3-6-22(28)31-23-19(26)11-15(13-21(23)30-2)12-20-25(29)32-24(27-20)18-10-9-16-7-4-5-8-17(16)14-18/h4-5,7-14H,3,6H2,1-2H3/b20-12- |
| InChIKey | QZLSXNJJIOWXIT-NDENLUEZSA-N |
| XLogP | 5.55 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|