C21H17Cl2NO5 — CID 19672659
[4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate (PubChem CID 19672659) has the molecular formula C21H17Cl2NO5 and a molecular weight of 434.28 g/mol. Its IUPAC name is [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate.
| Compound Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 19672659 |
| Molecular Formula | C21H17Cl2NO5 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H17Cl2NO5/c1-3-4-19(25)28-17-8-5-12(10-18(17)27-2)9-16-21(26)29-20(24-16)13-6-7-14(22)15(23)11-13/h5-11H,3-4H2,1-2H3/b16-9- |
| InChIKey | NWMCDXNSQQVEFR-SXGWCWSVSA-N |
| XLogP | 5.05 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|