C25H17Cl2NO5 — CID 19672980
(4Z)-2-(3,4-dichlorophenyl)-4-[(3-methoxy-4-phenacyloxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19672980) has the molecular formula C25H17Cl2NO5 and a molecular weight of 482.32 g/mol. Its IUPAC name is (4Z)-2-(3,4-dichlorophenyl)-4-[(3-methoxy-4-phenacyloxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(3-methoxy-4-phenacyloxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19672980 |
| Molecular Formula | C25H17Cl2NO5 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(3-methoxy-4-phenacyloxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)ccc1OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H17Cl2NO5/c1-31-23-12-15(7-10-22(23)32-14-21(29)16-5-3-2-4-6-16)11-20-25(30)33-24(28-20)17-8-9-18(26)19(27)13-17/h2-13H,14H2,1H3/b20-11- |
| InChIKey | YZQHEQIJFWXGSV-JAIQZWGSSA-N |
| XLogP | 5.61 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|