C23H23NO6 — CID 9052018
2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 9052018) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 9052018 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C(C)(C)C)cc3)OC2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C23H23NO6/c1-23(2,3)16-8-6-15(7-9-16)21-24-17(22(27)30-21)11-14-5-10-18(19(12-14)28-4)29-13-20(25)26/h5-12H,13H2,1-4H3,(H,25,26)/b17-11- |
| InChIKey | FVTOFQYSZNMAAE-BOPFTXTBSA-N |
| XLogP | 3.80 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|