C20H16FNO6 — CID 19669906
methyl 2-[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 19669906) has the molecular formula C20H16FNO6 and a molecular weight of 385.35 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 19669906 |
| Molecular Formula | C20H16FNO6 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | methyl 2-[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2\N=C(c3ccc(F)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H16FNO6/c1-25-17-10-12(3-8-16(17)27-11-18(23)26-2)9-15-20(24)28-19(22-15)13-4-6-14(21)7-5-13/h3-10H,11H2,1-2H3/b15-9- |
| InChIKey | WINCVMFUNGEDLW-DHDCSXOGSA-N |
| XLogP | 2.73 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|