C19H15FN2O5 — CID 22110250
2-[4-[(Z)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 22110250) has the molecular formula C19H15FN2O5 and a molecular weight of 370.34 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 22110250 |
| Molecular Formula | C19H15FN2O5 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[4-[(Z)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\N=C(c3cccc(F)c3)OC2=O)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H15FN2O5/c1-25-16-8-11(5-6-15(16)26-10-17(21)23)7-14-19(24)27-18(22-14)12-3-2-4-13(20)9-12/h2-9H,10H2,1H3,(H2,21,23)/b14-7- |
| InChIKey | CDUGFRJQFDXRSA-AUWJEWJLSA-N |
| XLogP | 2.04 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|