C21H18ClNO6 — CID 78414630
ethyl 2-[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 78414630) has the molecular formula C21H18ClNO6 and a molecular weight of 415.83 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 78414630 |
| Molecular Formula | C21H18ClNO6 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | ethyl 2-[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C2N=C(c3cccc(Cl)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H18ClNO6/c1-3-27-19(24)12-28-17-8-7-13(10-18(17)26-2)9-16-21(25)29-20(23-16)14-5-4-6-15(22)11-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | BGUCOYKMNMYENJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|