C21H17Cl2NO6 — CID 19670371
ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 19670371) has the molecular formula C21H17Cl2NO6 and a molecular weight of 450.27 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 19670371 |
| Molecular Formula | C21H17Cl2NO6 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)cc1OC |
| InChI | InChI=1S/C21H17Cl2NO6/c1-3-28-19(25)11-29-17-7-4-12(9-18(17)27-2)8-16-21(26)30-20(24-16)14-6-5-13(22)10-15(14)23/h4-10H,3,11H2,1-2H3/b16-8- |
| InChIKey | TZKBOPBKHRSLRM-PXNMLYILSA-N |
| XLogP | 4.29 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|