C19H14ClF2NO4 — CID 1389478
(4E)-2-(2-chloro-4,5-difluorophenyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 1389478) has the molecular formula C19H14ClF2NO4 and a molecular weight of 393.77 g/mol. Its IUPAC name is (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1389478 |
| Molecular Formula | C19H14ClF2NO4 |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(/C=C2/N=C(c3cc(F)c(F)cc3Cl)OC2=O)cc1OC |
| InChI | InChI=1S/C19H14ClF2NO4/c1-3-26-16-5-4-10(7-17(16)25-2)6-15-19(24)27-18(23-15)11-8-13(21)14(22)9-12(11)20/h4-9H,3H2,1-2H3/b15-6+ |
| InChIKey | LSWNATWQUAVUEE-GIDUJCDVSA-N |
| XLogP | 4.37 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|