C18H12ClF2NO4 — CID 4125813
2-(2-chloro-4,5-difluorophenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 4125813) has the molecular formula C18H12ClF2NO4 and a molecular weight of 379.75 g/mol. Its IUPAC name is 2-(2-chloro-4,5-difluorophenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4125813 |
| Molecular Formula | C18H12ClF2NO4 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(3,4-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(C=C2N=C(c3cc(F)c(F)cc3Cl)OC2=O)cc1OC |
| InChI | InChI=1S/C18H12ClF2NO4/c1-24-15-4-3-9(6-16(15)25-2)5-14-18(23)26-17(22-14)10-7-12(20)13(21)8-11(10)19/h3-8H,1-2H3 |
| InChIKey | AIIAMFGIAYOLLA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|