C19H14ClF2NO2 — CID 4295921
2-(2-chloro-4,5-difluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 4295921) has the molecular formula C19H14ClF2NO2 and a molecular weight of 361.78 g/mol. Its IUPAC name is 2-(2-chloro-4,5-difluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4295921 |
| Molecular Formula | C19H14ClF2NO2 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)c1ccc(C=C2N=C(c3cc(F)c(F)cc3Cl)OC2=O)cc1 |
| InChI | InChI=1S/C19H14ClF2NO2/c1-10(2)12-5-3-11(4-6-12)7-17-19(24)25-18(23-17)13-8-15(21)16(22)9-14(13)20/h3-10H,1-2H3 |
| InChIKey | GIEDTGGJPSTUSR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|