C22H21ClF2N2O2 — CID 6261305
(4E)-2-(2-chloro-4,5-difluorophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6261305) has the molecular formula C22H21ClF2N2O2 and a molecular weight of 418.87 g/mol. Its IUPAC name is (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6261305 |
| Molecular Formula | C22H21ClF2N2O2 |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (4E)-2-(2-chloro-4,5-difluorophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCCN(CCC)c1ccc(/C=C2/N=C(c3cc(F)c(F)cc3Cl)OC2=O)cc1 |
| InChI | InChI=1S/C22H21ClF2N2O2/c1-3-9-27(10-4-2)15-7-5-14(6-8-15)11-20-22(28)29-21(26-20)16-12-18(24)19(25)13-17(16)23/h5-8,11-13H,3-4,9-10H2,1-2H3/b20-11+ |
| InChIKey | BZWVIQYEHBFEQL-RGVLZGJSSA-N |
| XLogP | 5.59 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|