C19H17ClN2O3 — CID 3913849
2-(5-chloro-2-methoxyphenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 3913849) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3913849 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(Cl)cc1C1=NC(=Cc2ccc(N(C)C)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-22(2)14-7-4-12(5-8-14)10-16-19(23)25-18(21-16)15-11-13(20)6-9-17(15)24-3/h4-11H,1-3H3 |
| InChIKey | QBSVSHYDTGTKNJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|