C18H12ClNO5 — CID 5145611
4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 5145611) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5145611 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(Cl)cc1C1=NC(=Cc2ccc3c(c2)OCO3)C(=O)O1 |
| InChI | InChI=1S/C18H12ClNO5/c1-22-14-5-3-11(19)8-12(14)17-20-13(18(21)25-17)6-10-2-4-15-16(7-10)24-9-23-15/h2-8H,9H2,1H3 |
| InChIKey | CRNCZWZKXFRDFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|