C18H12N2O7 — CID 6090207
(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 6090207) has the molecular formula C18H12N2O7 and a molecular weight of 368.30 g/mol. Its IUPAC name is (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6090207 |
| Molecular Formula | C18H12N2O7 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc4c(c3)OCO4)C(=O)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N2O7/c1-24-14-5-3-11(8-13(14)20(22)23)17-19-12(18(21)27-17)6-10-2-4-15-16(7-10)26-9-25-15/h2-8H,9H2,1H3/b12-6- |
| InChIKey | FFODDADRXSJLOL-SDQBBNPISA-N |
| XLogP | 2.68 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|