C19H15NO4 — CID 4262125
4-(1,3-benzodioxol-5-ylmethylidene)-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one (PubChem CID 4262125) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4262125 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=NC(=Cc3ccc4c(c3)OCO4)C(=O)O2)cc1C |
| InChI | InChI=1S/C19H15NO4/c1-11-3-5-14(7-12(11)2)18-20-15(19(21)24-18)8-13-4-6-16-17(9-13)23-10-22-16/h3-9H,10H2,1-2H3 |
| InChIKey | XUMUGDKGDFTIJM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|